| Name | THIENO(3 2-B)PYRIDIN-7-OL |
| Synonyms | THIENO(3 2-B)PYRIDIN-7-OL Thieno[3,2-b]pyridin-7-ol 7-Hydroxythieno[3,2-b]pyridine thieno[3,2-b]pyridin-7(4H)-one Thieno[3,2-b]pyridin-7-ol 7-Hydroxythieno[3,2-b]pyridine |
| CAS | 107818-20-2 |
| EINECS | 626-962-7 |
| InChI | InChI=1/C9H10O3/c1-6-7(9(10)11)4-3-5-8(6)12-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | AACVULYSNJAKEQ-UHFFFAOYSA-N |
| Molecular Formula | C7H5NOS |
| Molar Mass | 151.19 |
| Density | 1.444±0.06 g/cm3(Predicted) |
| Melting Point | 230-235°C(lit.) |
| Boling Point | 321.4±22.0 °C(Predicted) |
| Flash Point | 119.9°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 0.000622mmHg at 25°C |
| pKa | 4.05±0.40(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.54 |
| Physical and Chemical Properties | WGK Germany:3 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29349990 |